About 2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]ethanethioamide
2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]ethanethioamide (PubChem CID 2350672) has the molecular formula C11H9ClN2S2
and a molecular weight of 268.79 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]ethanethioamide.
Molecular Properties
| Compound Name | 2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]ethanethioamide |
| PubChem CID | 2350672 |
| Molecular Formula | C11H9ClN2S2 |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 267.99 |
| IUPAC Name | 2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]ethanethioamide |
| SMILES | NC(=S)Cc1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C11H9ClN2S2/c12-8-3-1-7(2-4-8)9-6-16-11(14-9)5-10(13)15/h1-4,6H,5H2,(H2,13,15) |
| InChIKey | XVCRXJQJSLVXCU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]ethanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]ethanethioamide?
The IUPAC name of 2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]ethanethioamide (CID 2350672) is 2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]ethanethioamide.
What is the SMILES notation for 2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]ethanethioamide?
The canonical SMILES for 2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]ethanethioamide is NC(=S)Cc1nc(-c2ccc(Cl)cc2)cs1.
What is the InChIKey of 2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]ethanethioamide?
The InChIKey is XVCRXJQJSLVXCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9ClN2S2/c12-8-3-1-7(2-4-8)9-6-16-11(14-9)5-10(13)15/h1-4,6H,5H2,(H2,13,15).
What are the key properties of 2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]ethanethioamide?
2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]ethanethioamide has a molecular weight of 268.79 g/mol, XLogP of 3.29, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]ethanethioamide is sourced from PubChem (CID 2350672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).