C18H28N2O2 — CID 23506980
tert-butyl N-[(4-aminophenyl)methyl]-N-cyclohexylcarbamate (PubChem CID 23506980) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is tert-butyl N-[(4-aminophenyl)methyl]-N-cyclohexylcarbamate.
| Compound Name | tert-butyl N-[(4-aminophenyl)methyl]-N-cyclohexylcarbamate |
|---|---|
| PubChem CID | 23506980 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | tert-butyl N-[(4-aminophenyl)methyl]-N-cyclohexylcarbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1ccc(N)cc1)C1CCCCC1 |
| InChI | InChI=1S/C18H28N2O2/c1-18(2,3)22-17(21)20(16-7-5-4-6-8-16)13-14-9-11-15(19)12-10-14/h9-12,16H,4-8,13,19H2,1-3H3 |
| InChIKey | QIJYFIKMBCJHHI-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|