C20H29N3 — CID 23507494
4-[[heptan-3-yl(pyridin-2-ylmethyl)amino]methyl]aniline (PubChem CID 23507494) has the molecular formula C20H29N3 and a molecular weight of 311.47 g/mol. Its IUPAC name is 4-[[heptan-3-yl(pyridin-2-ylmethyl)amino]methyl]aniline.
| Compound Name | 4-[[heptan-3-yl(pyridin-2-ylmethyl)amino]methyl]aniline |
|---|---|
| PubChem CID | 23507494 |
| Molecular Formula | C20H29N3 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.24 |
| IUPAC Name | 4-[[heptan-3-yl(pyridin-2-ylmethyl)amino]methyl]aniline |
| SMILES | CCCCC(CC)N(Cc1ccc(N)cc1)Cc1ccccn1 |
| InChI | InChI=1S/C20H29N3/c1-3-5-9-20(4-2)23(16-19-8-6-7-14-22-19)15-17-10-12-18(21)13-11-17/h6-8,10-14,20H,3-5,9,15-16,21H2,1-2H3 |
| InChIKey | YBAQFEKXVDPFLV-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|