About 9aH-quinolizine-1,4-dione
9aH-quinolizine-1,4-dione (PubChem CID 23507772) has the molecular formula C9H7NO2
and a molecular weight of 161.16 g/mol. Its IUPAC name is 9aH-quinolizine-1,4-dione.
Molecular Properties
| Compound Name | 9aH-quinolizine-1,4-dione |
| PubChem CID | 23507772 |
| Molecular Formula | C9H7NO2 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | 9aH-quinolizine-1,4-dione |
| SMILES | O=C1C=CC(=O)N2C=CC=CC12 |
| InChI | InChI=1S/C9H7NO2/c11-8-4-5-9(12)10-6-2-1-3-7(8)10/h1-7H |
| InChIKey | DXJPPKKNILDYDI-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9aH-quinolizine-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9aH-quinolizine-1,4-dione?
The IUPAC name of 9aH-quinolizine-1,4-dione (CID 23507772) is 9aH-quinolizine-1,4-dione.
What is the SMILES notation for 9aH-quinolizine-1,4-dione?
The canonical SMILES for 9aH-quinolizine-1,4-dione is O=C1C=CC(=O)N2C=CC=CC12.
What is the InChIKey of 9aH-quinolizine-1,4-dione?
The InChIKey is DXJPPKKNILDYDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO2/c11-8-4-5-9(12)10-6-2-1-3-7(8)10/h1-7H.
What are the key properties of 9aH-quinolizine-1,4-dione?
9aH-quinolizine-1,4-dione has a molecular weight of 161.16 g/mol, XLogP of 0.41, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9aH-quinolizine-1,4-dione is sourced from PubChem (CID 23507772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).