About 1-[(2,2-difluoroacetyl)amino]-1-methylurea
1-[(2,2-difluoroacetyl)amino]-1-methylurea (PubChem CID 23508224) has the molecular formula C4H7F2N3O2
and a molecular weight of 167.12 g/mol. Its IUPAC name is 1-[(2,2-difluoroacetyl)amino]-1-methylurea.
Molecular Properties
| Compound Name | 1-[(2,2-difluoroacetyl)amino]-1-methylurea |
| PubChem CID | 23508224 |
| Molecular Formula | C4H7F2N3O2 |
| Molecular Weight | 167.12 g/mol |
| Exact Mass | 167.05 |
| IUPAC Name | 1-[(2,2-difluoroacetyl)amino]-1-methylurea |
| SMILES | CN(NC(=O)C(F)F)C(N)=O |
| InChI | InChI=1S/C4H7F2N3O2/c1-9(4(7)11)8-3(10)2(5)6/h2H,1H3,(H2,7,11)(H,8,10) |
| InChIKey | XOKUXCRAZMUNQI-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.12 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2,2-difluoroacetyl)amino]-1-methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,2-difluoroacetyl)amino]-1-methylurea?
The IUPAC name of 1-[(2,2-difluoroacetyl)amino]-1-methylurea (CID 23508224) is 1-[(2,2-difluoroacetyl)amino]-1-methylurea.
What is the SMILES notation for 1-[(2,2-difluoroacetyl)amino]-1-methylurea?
The canonical SMILES for 1-[(2,2-difluoroacetyl)amino]-1-methylurea is CN(NC(=O)C(F)F)C(N)=O.
What is the InChIKey of 1-[(2,2-difluoroacetyl)amino]-1-methylurea?
The InChIKey is XOKUXCRAZMUNQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7F2N3O2/c1-9(4(7)11)8-3(10)2(5)6/h2H,1H3,(H2,7,11)(H,8,10).
What are the key properties of 1-[(2,2-difluoroacetyl)amino]-1-methylurea?
1-[(2,2-difluoroacetyl)amino]-1-methylurea has a molecular weight of 167.12 g/mol, XLogP of -0.71, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,2-difluoroacetyl)amino]-1-methylurea is sourced from PubChem (CID 23508224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).