C24H27F2NO3 — CID 23508957
(E)-3-(difluoromethoxy)-N-[2-(4-methoxy-3-methylphenyl)ethyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yl)prop-2-enamide (PubChem CID 23508957) has the molecular formula C24H27F2NO3 and a molecular weight of 415.48 g/mol. Its IUPAC name is (E)-3-(difluoromethoxy)-N-[2-(4-methoxy-3-methylphenyl)ethyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(difluoromethoxy)-N-[2-(4-methoxy-3-methylphenyl)ethyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 23508957 |
| Molecular Formula | C24H27F2NO3 |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | (E)-3-(difluoromethoxy)-N-[2-(4-methoxy-3-methylphenyl)ethyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yl)prop-2-enamide |
| SMILES | COc1ccc(CCNC(=O)/C(=C/OC(F)F)c2ccc3c(c2)CCCC3)cc1C |
| InChI | InChI=1S/C24H27F2NO3/c1-16-13-17(7-10-22(16)29-2)11-12-27-23(28)21(15-30-24(25)26)20-9-8-18-5-3-4-6-19(18)14-20/h7-10,13-15,24H,3-6,11-12H2,1-2H3,(H,27,28)/b21-15+ |
| InChIKey | IMQNWRPOLWQOHF-RCCKNPSSSA-N |
| XLogP | 4.82 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|