About methanamine;2-methylpropanal
methanamine;2-methylpropanal (PubChem CID 23509049) has the molecular formula C5H13NO
and a molecular weight of 103.16 g/mol. Its IUPAC name is methanamine;2-methylpropanal.
Molecular Properties
| Compound Name | methanamine;2-methylpropanal |
| PubChem CID | 23509049 |
| Molecular Formula | C5H13NO |
| Molecular Weight | 103.16 g/mol |
| Exact Mass | 103.10 |
| IUPAC Name | methanamine;2-methylpropanal |
| SMILES | CC(C)C=O.CN |
| InChI | InChI=1S/C4H8O.CH5N/c1-4(2)3-5;1-2/h3-4H,1-2H3;2H2,1H3 |
| InChIKey | ANZRWLUUQINUSZ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.16 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze methanamine;2-methylpropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;2-methylpropanal?
The IUPAC name of methanamine;2-methylpropanal (CID 23509049) is methanamine;2-methylpropanal.
What is the SMILES notation for methanamine;2-methylpropanal?
The canonical SMILES for methanamine;2-methylpropanal is CC(C)C=O.CN.
What is the InChIKey of methanamine;2-methylpropanal?
The InChIKey is ANZRWLUUQINUSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O.CH5N/c1-4(2)3-5;1-2/h3-4H,1-2H3;2H2,1H3.
What are the key properties of methanamine;2-methylpropanal?
methanamine;2-methylpropanal has a molecular weight of 103.16 g/mol, XLogP of 0.42, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;2-methylpropanal is sourced from PubChem (CID 23509049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).