2-(dimethylamino)-4-methyl-1,3-thiazole-5-carboxylic acid

C7H10N2O2S — CID 23509747

IUPAC2-(dimethylamino)-4-methyl-1,3-thiazole-5-carboxylic acid
SMILESCc1nc(N(C)C)sc1C(=O)O
InChIInChI=1S/C7H10N2O2S/c1-4-5(6(10)11)12-7(8-4)9(2)3/h1-3H3,(H,10,11)
InChIKeyAWFVJEVQVOMTOD-UHFFFAOYSA-N
MW186.24 g/mol
LogP1.22
Rot. Bonds2

About 2-(dimethylamino)-4-methyl-1,3-thiazole-5-carboxylic acid

2-(dimethylamino)-4-methyl-1,3-thiazole-5-carboxylic acid (PubChem CID 23509747) has the molecular formula C7H10N2O2S and a molecular weight of 186.24 g/mol. Its IUPAC name is 2-(dimethylamino)-4-methyl-1,3-thiazole-5-carboxylic acid.

Molecular Properties

Compound Name2-(dimethylamino)-4-methyl-1,3-thiazole-5-carboxylic acid
PubChem CID23509747
Molecular FormulaC7H10N2O2S
Molecular Weight186.24 g/mol
Exact Mass186.05
IUPAC Name2-(dimethylamino)-4-methyl-1,3-thiazole-5-carboxylic acid
SMILESCc1nc(N(C)C)sc1C(=O)O
InChIInChI=1S/C7H10N2O2S/c1-4-5(6(10)11)12-7(8-4)9(2)3/h1-3H3,(H,10,11)
InChIKeyAWFVJEVQVOMTOD-UHFFFAOYSA-N
XLogP1.22
TPSA53.43 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.24
LogP ≤ 51.22
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(dimethylamino)-4-methyl-1,3-thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(dimethylamino)-4-methyl-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-(dimethylamino)-4-methyl-1,3-thiazole-5-carboxylic acid (CID 23509747) is 2-(dimethylamino)-4-methyl-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-(dimethylamino)-4-methyl-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-(dimethylamino)-4-methyl-1,3-thiazole-5-carboxylic acid is Cc1nc(N(C)C)sc1C(=O)O.
What is the InChIKey of 2-(dimethylamino)-4-methyl-1,3-thiazole-5-carboxylic acid?
The InChIKey is AWFVJEVQVOMTOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2S/c1-4-5(6(10)11)12-7(8-4)9(2)3/h1-3H3,(H,10,11).
What are the key properties of 2-(dimethylamino)-4-methyl-1,3-thiazole-5-carboxylic acid?
2-(dimethylamino)-4-methyl-1,3-thiazole-5-carboxylic acid has a molecular weight of 186.24 g/mol, XLogP of 1.22, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)-4-methyl-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 23509747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).