1H-pyrido[4,3-b]indole-8-carboxylic acid

C12H8N2O2 — CID 23510174

IUPAC1H-pyrido[4,3-b]indole-8-carboxylic acid
SMILESO=C(O)c1ccc2c(c1)=C1CN=CC=C1N=2
InChIInChI=1S/C12H8N2O2/c15-12(16)7-1-2-10-8(5-7)9-6-13-4-3-11(9)14-10/h1-5H,6H2,(H,15,16)
InChIKeyJGPDQBKQPTYOEF-UHFFFAOYSA-N
MW212.21 g/mol
LogP0.14
Rot. Bonds1

About 1H-pyrido[4,3-b]indole-8-carboxylic acid

1H-pyrido[4,3-b]indole-8-carboxylic acid (PubChem CID 23510174) has the molecular formula C12H8N2O2 and a molecular weight of 212.21 g/mol. Its IUPAC name is 1H-pyrido[4,3-b]indole-8-carboxylic acid.

Molecular Properties

Compound Name1H-pyrido[4,3-b]indole-8-carboxylic acid
PubChem CID23510174
Molecular FormulaC12H8N2O2
Molecular Weight212.21 g/mol
Exact Mass212.06
IUPAC Name1H-pyrido[4,3-b]indole-8-carboxylic acid
SMILESO=C(O)c1ccc2c(c1)=C1CN=CC=C1N=2
InChIInChI=1S/C12H8N2O2/c15-12(16)7-1-2-10-8(5-7)9-6-13-4-3-11(9)14-10/h1-5H,6H2,(H,15,16)
InChIKeyJGPDQBKQPTYOEF-UHFFFAOYSA-N
XLogP0.14
TPSA62.02 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.21
LogP ≤ 50.14
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 1H-pyrido[4,3-b]indole-8-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1H-pyrido[4,3-b]indole-8-carboxylic acid?
The IUPAC name of 1H-pyrido[4,3-b]indole-8-carboxylic acid (CID 23510174) is 1H-pyrido[4,3-b]indole-8-carboxylic acid.
What is the SMILES notation for 1H-pyrido[4,3-b]indole-8-carboxylic acid?
The canonical SMILES for 1H-pyrido[4,3-b]indole-8-carboxylic acid is O=C(O)c1ccc2c(c1)=C1CN=CC=C1N=2.
What is the InChIKey of 1H-pyrido[4,3-b]indole-8-carboxylic acid?
The InChIKey is JGPDQBKQPTYOEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2O2/c15-12(16)7-1-2-10-8(5-7)9-6-13-4-3-11(9)14-10/h1-5H,6H2,(H,15,16).
What are the key properties of 1H-pyrido[4,3-b]indole-8-carboxylic acid?
1H-pyrido[4,3-b]indole-8-carboxylic acid has a molecular weight of 212.21 g/mol, XLogP of 0.14, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrido[4,3-b]indole-8-carboxylic acid is sourced from PubChem (CID 23510174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).