About 1H-pyrido[4,3-b]indole-8-carboxylic acid
1H-pyrido[4,3-b]indole-8-carboxylic acid (PubChem CID 23510174) has the molecular formula C12H8N2O2
and a molecular weight of 212.21 g/mol. Its IUPAC name is 1H-pyrido[4,3-b]indole-8-carboxylic acid.
Molecular Properties
| Compound Name | 1H-pyrido[4,3-b]indole-8-carboxylic acid |
| PubChem CID | 23510174 |
| Molecular Formula | C12H8N2O2 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 1H-pyrido[4,3-b]indole-8-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)=C1CN=CC=C1N=2 |
| InChI | InChI=1S/C12H8N2O2/c15-12(16)7-1-2-10-8(5-7)9-6-13-4-3-11(9)14-10/h1-5H,6H2,(H,15,16) |
| InChIKey | JGPDQBKQPTYOEF-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 62.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-pyrido[4,3-b]indole-8-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrido[4,3-b]indole-8-carboxylic acid?
The IUPAC name of 1H-pyrido[4,3-b]indole-8-carboxylic acid (CID 23510174) is 1H-pyrido[4,3-b]indole-8-carboxylic acid.
What is the SMILES notation for 1H-pyrido[4,3-b]indole-8-carboxylic acid?
The canonical SMILES for 1H-pyrido[4,3-b]indole-8-carboxylic acid is O=C(O)c1ccc2c(c1)=C1CN=CC=C1N=2.
What is the InChIKey of 1H-pyrido[4,3-b]indole-8-carboxylic acid?
The InChIKey is JGPDQBKQPTYOEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2O2/c15-12(16)7-1-2-10-8(5-7)9-6-13-4-3-11(9)14-10/h1-5H,6H2,(H,15,16).
What are the key properties of 1H-pyrido[4,3-b]indole-8-carboxylic acid?
1H-pyrido[4,3-b]indole-8-carboxylic acid has a molecular weight of 212.21 g/mol, XLogP of 0.14, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrido[4,3-b]indole-8-carboxylic acid is sourced from PubChem (CID 23510174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).