About (4-methylphenyl)-(4-prop-2-enyl-1,2-thiazol-3-yl)methanol
(4-methylphenyl)-(4-prop-2-enyl-1,2-thiazol-3-yl)methanol (PubChem CID 23510350) has the molecular formula C14H15NOS
and a molecular weight of 245.35 g/mol. Its IUPAC name is (4-methylphenyl)-(4-prop-2-enyl-1,2-thiazol-3-yl)methanol.
Molecular Properties
| Compound Name | (4-methylphenyl)-(4-prop-2-enyl-1,2-thiazol-3-yl)methanol |
| PubChem CID | 23510350 |
| Molecular Formula | C14H15NOS |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | (4-methylphenyl)-(4-prop-2-enyl-1,2-thiazol-3-yl)methanol |
| SMILES | C=CCc1csnc1C(O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H15NOS/c1-3-4-12-9-17-15-13(12)14(16)11-7-5-10(2)6-8-11/h3,5-9,14,16H,1,4H2,2H3 |
| InChIKey | RDRUINHNXPYKPX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4-methylphenyl)-(4-prop-2-enyl-1,2-thiazol-3-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylphenyl)-(4-prop-2-enyl-1,2-thiazol-3-yl)methanol?
The IUPAC name of (4-methylphenyl)-(4-prop-2-enyl-1,2-thiazol-3-yl)methanol (CID 23510350) is (4-methylphenyl)-(4-prop-2-enyl-1,2-thiazol-3-yl)methanol.
What is the SMILES notation for (4-methylphenyl)-(4-prop-2-enyl-1,2-thiazol-3-yl)methanol?
The canonical SMILES for (4-methylphenyl)-(4-prop-2-enyl-1,2-thiazol-3-yl)methanol is C=CCc1csnc1C(O)c1ccc(C)cc1.
What is the InChIKey of (4-methylphenyl)-(4-prop-2-enyl-1,2-thiazol-3-yl)methanol?
The InChIKey is RDRUINHNXPYKPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NOS/c1-3-4-12-9-17-15-13(12)14(16)11-7-5-10(2)6-8-11/h3,5-9,14,16H,1,4H2,2H3.
What are the key properties of (4-methylphenyl)-(4-prop-2-enyl-1,2-thiazol-3-yl)methanol?
(4-methylphenyl)-(4-prop-2-enyl-1,2-thiazol-3-yl)methanol has a molecular weight of 245.35 g/mol, XLogP of 3.26, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylphenyl)-(4-prop-2-enyl-1,2-thiazol-3-yl)methanol is sourced from PubChem (CID 23510350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).