About dimethoxy-bis(2,3,4-trimethylcyclopentyl)silane
dimethoxy-bis(2,3,4-trimethylcyclopentyl)silane (PubChem CID 23510567) has the molecular formula C18H36O2Si
and a molecular weight of 312.57 g/mol. Its IUPAC name is dimethoxy-bis(2,3,4-trimethylcyclopentyl)silane.
Molecular Properties
| Compound Name | dimethoxy-bis(2,3,4-trimethylcyclopentyl)silane |
| PubChem CID | 23510567 |
| Molecular Formula | C18H36O2Si |
| Molecular Weight | 312.57 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | dimethoxy-bis(2,3,4-trimethylcyclopentyl)silane |
| SMILES | CO[Si](OC)(C1CC(C)C(C)C1C)C1CC(C)C(C)C1C |
| InChI | InChI=1S/C18H36O2Si/c1-11-9-17(15(5)13(11)3)21(19-7,20-8)18-10-12(2)14(4)16(18)6/h11-18H,9-10H2,1-8H3 |
| InChIKey | ALLDQILNJFTSLN-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.57 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethoxy-bis(2,3,4-trimethylcyclopentyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethoxy-bis(2,3,4-trimethylcyclopentyl)silane?
The IUPAC name of dimethoxy-bis(2,3,4-trimethylcyclopentyl)silane (CID 23510567) is dimethoxy-bis(2,3,4-trimethylcyclopentyl)silane.
What is the SMILES notation for dimethoxy-bis(2,3,4-trimethylcyclopentyl)silane?
The canonical SMILES for dimethoxy-bis(2,3,4-trimethylcyclopentyl)silane is CO[Si](OC)(C1CC(C)C(C)C1C)C1CC(C)C(C)C1C.
What is the InChIKey of dimethoxy-bis(2,3,4-trimethylcyclopentyl)silane?
The InChIKey is ALLDQILNJFTSLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O2Si/c1-11-9-17(15(5)13(11)3)21(19-7,20-8)18-10-12(2)14(4)16(18)6/h11-18H,9-10H2,1-8H3.
What are the key properties of dimethoxy-bis(2,3,4-trimethylcyclopentyl)silane?
dimethoxy-bis(2,3,4-trimethylcyclopentyl)silane has a molecular weight of 312.57 g/mol, XLogP of 5.09, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dimethoxy-bis(2,3,4-trimethylcyclopentyl)silane is sourced from PubChem (CID 23510567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).