About 1-fluoro-3-methylbutane
1-fluoro-3-methylbutane (PubChem CID 23510607) has the molecular formula C5H11F
and a molecular weight of 90.14 g/mol. Its IUPAC name is 1-fluoro-3-methylbutane.
Molecular Properties
| Compound Name | 1-fluoro-3-methylbutane |
| PubChem CID | 23510607 |
| Molecular Formula | C5H11F |
| Molecular Weight | 90.14 g/mol |
| Exact Mass | 90.08 |
| IUPAC Name | 1-fluoro-3-methylbutane |
| SMILES | CC(C)CCF |
| InChI | InChI=1S/C5H11F/c1-5(2)3-4-6/h5H,3-4H2,1-2H3 |
| InChIKey | TVHQEXCGMKZBME-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 90.14 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-fluoro-3-methylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-3-methylbutane?
The IUPAC name of 1-fluoro-3-methylbutane (CID 23510607) is 1-fluoro-3-methylbutane.
What is the SMILES notation for 1-fluoro-3-methylbutane?
The canonical SMILES for 1-fluoro-3-methylbutane is CC(C)CCF.
What is the InChIKey of 1-fluoro-3-methylbutane?
The InChIKey is TVHQEXCGMKZBME-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11F/c1-5(2)3-4-6/h5H,3-4H2,1-2H3.
What are the key properties of 1-fluoro-3-methylbutane?
1-fluoro-3-methylbutane has a molecular weight of 90.14 g/mol, XLogP of 2.00, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-3-methylbutane is sourced from PubChem (CID 23510607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).