About N,N-diethylprop-2-enamide;prop-2-enal
N,N-diethylprop-2-enamide;prop-2-enal (PubChem CID 23511066) has the molecular formula C10H17NO2
and a molecular weight of 183.25 g/mol. Its IUPAC name is N,N-diethylprop-2-enamide;prop-2-enal.
Molecular Properties
| Compound Name | N,N-diethylprop-2-enamide;prop-2-enal |
| PubChem CID | 23511066 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | N,N-diethylprop-2-enamide;prop-2-enal |
| SMILES | C=CC(=O)N(CC)CC.C=CC=O |
| InChI | InChI=1S/C7H13NO.C3H4O/c1-4-7(9)8(5-2)6-3;1-2-3-4/h4H,1,5-6H2,2-3H3;2-3H,1H2 |
| InChIKey | NWCDPLUXTDVLAS-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethylprop-2-enamide;prop-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylprop-2-enamide;prop-2-enal?
The IUPAC name of N,N-diethylprop-2-enamide;prop-2-enal (CID 23511066) is N,N-diethylprop-2-enamide;prop-2-enal.
What is the SMILES notation for N,N-diethylprop-2-enamide;prop-2-enal?
The canonical SMILES for N,N-diethylprop-2-enamide;prop-2-enal is C=CC(=O)N(CC)CC.C=CC=O.
What is the InChIKey of N,N-diethylprop-2-enamide;prop-2-enal?
The InChIKey is NWCDPLUXTDVLAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO.C3H4O/c1-4-7(9)8(5-2)6-3;1-2-3-4/h4H,1,5-6H2,2-3H3;2-3H,1H2.
What are the key properties of N,N-diethylprop-2-enamide;prop-2-enal?
N,N-diethylprop-2-enamide;prop-2-enal has a molecular weight of 183.25 g/mol, XLogP of 1.41, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylprop-2-enamide;prop-2-enal is sourced from PubChem (CID 23511066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).