C22H21ClO6S2 — CID 23511271
3-benzylsulfonyl-2-(4-chloro-1,1-dioxo-2,3-dihydro-1-benzothiophene-5-carbonyl)cyclohexan-1-one (PubChem CID 23511271) has the molecular formula C22H21ClO6S2 and a molecular weight of 480.99 g/mol. Its IUPAC name is 3-benzylsulfonyl-2-(4-chloro-1,1-dioxo-2,3-dihydro-1-benzothiophene-5-carbonyl)cyclohexan-1-one.
| Compound Name | 3-benzylsulfonyl-2-(4-chloro-1,1-dioxo-2,3-dihydro-1-benzothiophene-5-carbonyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 23511271 |
| Molecular Formula | C22H21ClO6S2 |
| Molecular Weight | 480.99 g/mol |
| Exact Mass | 480.05 |
| IUPAC Name | 3-benzylsulfonyl-2-(4-chloro-1,1-dioxo-2,3-dihydro-1-benzothiophene-5-carbonyl)cyclohexan-1-one |
| SMILES | O=C1CCCC(S(=O)(=O)Cc2ccccc2)C1C(=O)c1ccc2c(c1Cl)CCS2(=O)=O |
| InChI | InChI=1S/C22H21ClO6S2/c23-21-15-11-12-30(26,27)18(15)10-9-16(21)22(25)20-17(24)7-4-8-19(20)31(28,29)13-14-5-2-1-3-6-14/h1-3,5-6,9-10,19-20H,4,7-8,11-13H2 |
| InChIKey | QHJZIAVIHCKSMI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.99 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|