C18H19ClO4S2 — CID 23511319
2-(4-chloro-1,1-dioxo-2,3-dihydro-1-benzothiophene-5-carbonyl)-3-prop-2-enylsulfanylcyclohexan-1-one (PubChem CID 23511319) has the molecular formula C18H19ClO4S2 and a molecular weight of 398.93 g/mol. Its IUPAC name is 2-(4-chloro-1,1-dioxo-2,3-dihydro-1-benzothiophene-5-carbonyl)-3-prop-2-enylsulfanylcyclohexan-1-one.
| Compound Name | 2-(4-chloro-1,1-dioxo-2,3-dihydro-1-benzothiophene-5-carbonyl)-3-prop-2-enylsulfanylcyclohexan-1-one |
|---|---|
| PubChem CID | 23511319 |
| Molecular Formula | C18H19ClO4S2 |
| Molecular Weight | 398.93 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | 2-(4-chloro-1,1-dioxo-2,3-dihydro-1-benzothiophene-5-carbonyl)-3-prop-2-enylsulfanylcyclohexan-1-one |
| SMILES | C=CCSC1CCCC(=O)C1C(=O)c1ccc2c(c1Cl)CCS2(=O)=O |
| InChI | InChI=1S/C18H19ClO4S2/c1-2-9-24-14-5-3-4-13(20)16(14)18(21)12-6-7-15-11(17(12)19)8-10-25(15,22)23/h2,6-7,14,16H,1,3-5,8-10H2 |
| InChIKey | YXBMMSJEPJIHQS-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.93 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|