C27H33O3PS — CID 23511367
1,2,3-trimethyl-4-[(2,3,4-trimethylphenoxy)-(2,3,4-trimethylphenyl)sulfanylphosphoryl]oxybenzene (PubChem CID 23511367) has the molecular formula C27H33O3PS and a molecular weight of 468.60 g/mol. Its IUPAC name is 1,2,3-trimethyl-4-[(2,3,4-trimethylphenoxy)-(2,3,4-trimethylphenyl)sulfanylphosphoryl]oxybenzene.
| Compound Name | 1,2,3-trimethyl-4-[(2,3,4-trimethylphenoxy)-(2,3,4-trimethylphenyl)sulfanylphosphoryl]oxybenzene |
|---|---|
| PubChem CID | 23511367 |
| Molecular Formula | C27H33O3PS |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | 1,2,3-trimethyl-4-[(2,3,4-trimethylphenoxy)-(2,3,4-trimethylphenyl)sulfanylphosphoryl]oxybenzene |
| SMILES | Cc1ccc(OP(=O)(Oc2ccc(C)c(C)c2C)Sc2ccc(C)c(C)c2C)c(C)c1C |
| InChI | InChI=1S/C27H33O3PS/c1-16-10-13-25(22(7)19(16)4)29-31(28,30-26-14-11-17(2)20(5)23(26)8)32-27-15-12-18(3)21(6)24(27)9/h10-15H,1-9H3 |
| InChIKey | QBEYDPAKMNTPPJ-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|