C27H27BrN3O6+ — CID 23512499
4-[1-[2-[4-[(2-bromophenyl)carbamoylamino]-3-methoxyphenyl]acetyl]pyrrolidin-1-ium-1-yl]oxybenzoic acid (PubChem CID 23512499) has the molecular formula C27H27BrN3O6+ and a molecular weight of 569.43 g/mol. Its IUPAC name is 4-[1-[2-[4-[(2-bromophenyl)carbamoylamino]-3-methoxyphenyl]acetyl]pyrrolidin-1-ium-1-yl]oxybenzoic acid.
| Compound Name | 4-[1-[2-[4-[(2-bromophenyl)carbamoylamino]-3-methoxyphenyl]acetyl]pyrrolidin-1-ium-1-yl]oxybenzoic acid |
|---|---|
| PubChem CID | 23512499 |
| Molecular Formula | C27H27BrN3O6+ |
| Molecular Weight | 569.43 g/mol |
| Exact Mass | 568.11 |
| IUPAC Name | 4-[1-[2-[4-[(2-bromophenyl)carbamoylamino]-3-methoxyphenyl]acetyl]pyrrolidin-1-ium-1-yl]oxybenzoic acid |
| SMILES | COc1cc(CC(=O)[N+]2(Oc3ccc(C(=O)O)cc3)CCCC2)ccc1NC(=O)Nc1ccccc1Br |
| InChI | InChI=1S/C27H26BrN3O6/c1-36-24-16-18(8-13-23(24)30-27(35)29-22-7-3-2-6-21(22)28)17-25(32)31(14-4-5-15-31)37-20-11-9-19(10-12-20)26(33)34/h2-3,6-13,16H,4-5,14-15,17H2,1H3,(H2-,29,30,33,34,35)/p+1 |
| InChIKey | NJJXXSDYANFTLG-UHFFFAOYSA-O |
| XLogP | 5.47 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.43 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|