C22H21F3N6O2 — CID 23512706
N-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide (PubChem CID 23512706) has the molecular formula C22H21F3N6O2 and a molecular weight of 458.44 g/mol. Its IUPAC name is N-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide.
| Compound Name | N-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 23512706 |
| Molecular Formula | C22H21F3N6O2 |
| Molecular Weight | 458.44 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | N-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide |
| SMILES | Nc1nc2ccccc2c2c1ncn2CCCCNC(=O)c1ccc(OCC(F)(F)F)nc1 |
| InChI | InChI=1S/C22H21F3N6O2/c23-22(24,25)12-33-17-8-7-14(11-28-17)21(32)27-9-3-4-10-31-13-29-18-19(31)15-5-1-2-6-16(15)30-20(18)26/h1-2,5-8,11,13H,3-4,9-10,12H2,(H2,26,30)(H,27,32) |
| InChIKey | INKBMAFTIQZMHQ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|