About 7,9-diazatricyclo[4.3.0.07,9]nona-1,3,5-triene
7,9-diazatricyclo[4.3.0.07,9]nona-1,3,5-triene (PubChem CID 23512794) has the molecular formula C7H6N2
and a molecular weight of 118.14 g/mol. Its IUPAC name is 7,9-diazatricyclo[4.3.0.07,9]nona-1,3,5-triene.
Analyze 7,9-diazatricyclo[4.3.0.07,9]nona-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,9-diazatricyclo[4.3.0.07,9]nona-1,3,5-triene?
The IUPAC name of 7,9-diazatricyclo[4.3.0.07,9]nona-1,3,5-triene (CID 23512794) is 7,9-diazatricyclo[4.3.0.07,9]nona-1,3,5-triene.
What is the SMILES notation for 7,9-diazatricyclo[4.3.0.07,9]nona-1,3,5-triene?
The canonical SMILES for 7,9-diazatricyclo[4.3.0.07,9]nona-1,3,5-triene is c1ccc2c(c1)n1n2C1.
What is the InChIKey of 7,9-diazatricyclo[4.3.0.07,9]nona-1,3,5-triene?
The InChIKey is YVQHAXQIEXCCLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2/c1-2-4-7-6(3-1)8-5-9(7)8/h1-4H,5H2.
What are the key properties of 7,9-diazatricyclo[4.3.0.07,9]nona-1,3,5-triene?
7,9-diazatricyclo[4.3.0.07,9]nona-1,3,5-triene has a molecular weight of 118.14 g/mol, XLogP of 1.26, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,9-diazatricyclo[4.3.0.07,9]nona-1,3,5-triene is sourced from PubChem (CID 23512794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).