C60H81N3O6 — CID 23513090
1,3,5-tris[(3,5-dicyclohexyl-4-hydroxyphenyl)methyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 23513090) has the molecular formula C60H81N3O6 and a molecular weight of 940.32 g/mol. Its IUPAC name is 1,3,5-tris[(3,5-dicyclohexyl-4-hydroxyphenyl)methyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3,5-tris[(3,5-dicyclohexyl-4-hydroxyphenyl)methyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 23513090 |
| Molecular Formula | C60H81N3O6 |
| Molecular Weight | 940.32 g/mol |
| Exact Mass | 939.61 |
| IUPAC Name | 1,3,5-tris[(3,5-dicyclohexyl-4-hydroxyphenyl)methyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | O=c1n(Cc2cc(C3CCCCC3)c(O)c(C3CCCCC3)c2)c(=O)n(Cc2cc(C3CCCCC3)c(O)c(C3CCCCC3)c2)c(=O)n1Cc1cc(C2CCCCC2)c(O)c(C2CCCCC2)c1 |
| InChI | InChI=1S/C60H81N3O6/c64-55-49(43-19-7-1-8-20-43)31-40(32-50(55)44-21-9-2-10-22-44)37-61-58(67)62(38-41-33-51(45-23-11-3-12-24-45)56(65)52(34-41)46-25-13-4-14-26-46)60(69)63(59(61)68)39-42-35-53(47-27-15-5-16-28-47)57(66)54(36-42)48-29-17-6-18-30-48/h31-36,43-48,64-66H,1-30,37-39H2 |
| InChIKey | PKYNGKRCTDKWSY-UHFFFAOYSA-N |
| XLogP | 13.72 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 940.32 |
| LogP ≤ 5 | 13.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |