C19H30O2 — CID 23513105
2,5,7,8-tetramethyl-2-(4-methylpent-3-enyl)-4,4a-dihydro-3H-chromen-5-ol (PubChem CID 23513105) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is 2,5,7,8-tetramethyl-2-(4-methylpent-3-enyl)-4,4a-dihydro-3H-chromen-5-ol.
| Compound Name | 2,5,7,8-tetramethyl-2-(4-methylpent-3-enyl)-4,4a-dihydro-3H-chromen-5-ol |
|---|---|
| PubChem CID | 23513105 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 2,5,7,8-tetramethyl-2-(4-methylpent-3-enyl)-4,4a-dihydro-3H-chromen-5-ol |
| SMILES | CC(C)=CCCC1(C)CCC2C(=C(C)C(C)=CC2(C)O)O1 |
| InChI | InChI=1S/C19H30O2/c1-13(2)8-7-10-18(5)11-9-16-17(21-18)15(4)14(3)12-19(16,6)20/h8,12,16,20H,7,9-11H2,1-6H3 |
| InChIKey | VRMPKVZVNCRAPM-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|