C9H17N3 — CID 23513305
2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-6-amine (PubChem CID 23513305) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-6-amine.
| Compound Name | 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-6-amine |
|---|---|
| PubChem CID | 23513305 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepin-6-amine |
| SMILES | NC1CCCCC2=NCCCN21 |
| InChI | InChI=1S/C9H17N3/c10-8-4-1-2-5-9-11-6-3-7-12(8)9/h8H,1-7,10H2 |
| InChIKey | YCNYPSPCROPLMZ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |