C5H5N3O3 — CID 23513449
1-ethenyl-1,3,5-triazinane-2,4,6-trione (PubChem CID 23513449) has the molecular formula C5H5N3O3 and a molecular weight of 155.11 g/mol. Its IUPAC name is 1-ethenyl-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-ethenyl-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 23513449 |
| Molecular Formula | C5H5N3O3 |
| Molecular Weight | 155.11 g/mol |
| Exact Mass | 155.03 |
| IUPAC Name | 1-ethenyl-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=Cn1c(=O)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C5H5N3O3/c1-2-8-4(10)6-3(9)7-5(8)11/h2H,1H2,(H2,6,7,9,10,11) |
| InChIKey | WOYMLDFQQRAPJS-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 87.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.11 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |