About bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] bicyclo[2.2.1]hept-1(6)-ene-2,3-dicarboxylate
bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] bicyclo[2.2.1]hept-1(6)-ene-2,3-dicarboxylate (PubChem CID 23513507) has the molecular formula C21H30O8
and a molecular weight of 410.46 g/mol. Its IUPAC name is bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] bicyclo[2.2.1]hept-1(6)-ene-2,3-dicarboxylate.
Molecular Properties
| Compound Name | bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] bicyclo[2.2.1]hept-1(6)-ene-2,3-dicarboxylate |
| PubChem CID | 23513507 |
| Molecular Formula | C21H30O8 |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] bicyclo[2.2.1]hept-1(6)-ene-2,3-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)COC(=O)C1C2=CCC(C2)C1C(=O)OCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H30O8/c1-20(2,3)28-14(22)10-26-18(24)16-12-7-8-13(9-12)17(16)19(25)27-11-15(23)29-21(4,5)6/h7,13,16-17H,8-11H2,1-6H3 |
| InChIKey | PADLKINNRKJWQQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] bicyclo[2.2.1]hept-1(6)-ene-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] bicyclo[2.2.1]hept-1(6)-ene-2,3-dicarboxylate?
The IUPAC name of bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] bicyclo[2.2.1]hept-1(6)-ene-2,3-dicarboxylate (CID 23513507) is bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] bicyclo[2.2.1]hept-1(6)-ene-2,3-dicarboxylate.
What is the SMILES notation for bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] bicyclo[2.2.1]hept-1(6)-ene-2,3-dicarboxylate?
The canonical SMILES for bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] bicyclo[2.2.1]hept-1(6)-ene-2,3-dicarboxylate is CC(C)(C)OC(=O)COC(=O)C1C2=CCC(C2)C1C(=O)OCC(=O)OC(C)(C)C.
What is the InChIKey of bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] bicyclo[2.2.1]hept-1(6)-ene-2,3-dicarboxylate?
The InChIKey is PADLKINNRKJWQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H30O8/c1-20(2,3)28-14(22)10-26-18(24)16-12-7-8-13(9-12)17(16)19(25)27-11-15(23)29-21(4,5)6/h7,13,16-17H,8-11H2,1-6H3.
What are the key properties of bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] bicyclo[2.2.1]hept-1(6)-ene-2,3-dicarboxylate?
bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] bicyclo[2.2.1]hept-1(6)-ene-2,3-dicarboxylate has a molecular weight of 410.46 g/mol, XLogP of 2.34, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] bicyclo[2.2.1]hept-1(6)-ene-2,3-dicarboxylate is sourced from PubChem (CID 23513507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).