About 2-(4-chlorophenyl)sulfanyl-1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]ethanone
2-(4-chlorophenyl)sulfanyl-1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]ethanone (PubChem CID 2351351) has the molecular formula C15H20ClNOS
and a molecular weight of 297.85 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]ethanone.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)sulfanyl-1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]ethanone |
| PubChem CID | 2351351 |
| Molecular Formula | C15H20ClNOS |
| Molecular Weight | 297.85 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]ethanone |
| SMILES | C[C@H]1CCC[C@H](C)N1C(=O)CSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H20ClNOS/c1-11-4-3-5-12(2)17(11)15(18)10-19-14-8-6-13(16)7-9-14/h6-9,11-12H,3-5,10H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | QACVDGGTRYMQGD-RYUDHWBXSA-N |
| XLogP | 4.22 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.85 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-chlorophenyl)sulfanyl-1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)sulfanyl-1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]ethanone?
The IUPAC name of 2-(4-chlorophenyl)sulfanyl-1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]ethanone (CID 2351351) is 2-(4-chlorophenyl)sulfanyl-1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]ethanone.
What is the SMILES notation for 2-(4-chlorophenyl)sulfanyl-1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]ethanone?
The canonical SMILES for 2-(4-chlorophenyl)sulfanyl-1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]ethanone is C[C@H]1CCC[C@H](C)N1C(=O)CSc1ccc(Cl)cc1.
What is the InChIKey of 2-(4-chlorophenyl)sulfanyl-1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]ethanone?
The InChIKey is QACVDGGTRYMQGD-RYUDHWBXSA-N. The full InChI is InChI=1S/C15H20ClNOS/c1-11-4-3-5-12(2)17(11)15(18)10-19-14-8-6-13(16)7-9-14/h6-9,11-12H,3-5,10H2,1-2H3/t11-,12-/m0/s1.
What are the key properties of 2-(4-chlorophenyl)sulfanyl-1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]ethanone?
2-(4-chlorophenyl)sulfanyl-1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]ethanone has a molecular weight of 297.85 g/mol, XLogP of 4.22, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)sulfanyl-1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]ethanone is sourced from PubChem (CID 2351351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).