About 5-methyl-2-(2-methylpropyl)-1,3-dioxane
5-methyl-2-(2-methylpropyl)-1,3-dioxane (PubChem CID 23513560) has the molecular formula C9H18O2
and a molecular weight of 158.24 g/mol. Its IUPAC name is 5-methyl-2-(2-methylpropyl)-1,3-dioxane.
Molecular Properties
| Compound Name | 5-methyl-2-(2-methylpropyl)-1,3-dioxane |
| PubChem CID | 23513560 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | 5-methyl-2-(2-methylpropyl)-1,3-dioxane |
| SMILES | CC(C)CC1OCC(C)CO1 |
| InChI | InChI=1S/C9H18O2/c1-7(2)4-9-10-5-8(3)6-11-9/h7-9H,4-6H2,1-3H3 |
| InChIKey | MBEPJPZPFKXSPV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methyl-2-(2-methylpropyl)-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-(2-methylpropyl)-1,3-dioxane?
The IUPAC name of 5-methyl-2-(2-methylpropyl)-1,3-dioxane (CID 23513560) is 5-methyl-2-(2-methylpropyl)-1,3-dioxane.
What is the SMILES notation for 5-methyl-2-(2-methylpropyl)-1,3-dioxane?
The canonical SMILES for 5-methyl-2-(2-methylpropyl)-1,3-dioxane is CC(C)CC1OCC(C)CO1.
What is the InChIKey of 5-methyl-2-(2-methylpropyl)-1,3-dioxane?
The InChIKey is MBEPJPZPFKXSPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O2/c1-7(2)4-9-10-5-8(3)6-11-9/h7-9H,4-6H2,1-3H3.
What are the key properties of 5-methyl-2-(2-methylpropyl)-1,3-dioxane?
5-methyl-2-(2-methylpropyl)-1,3-dioxane has a molecular weight of 158.24 g/mol, XLogP of 2.04, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-(2-methylpropyl)-1,3-dioxane is sourced from PubChem (CID 23513560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).