C24H31NO8S — CID 23513837
4-(4-but-2-ynoxyphenyl)sulfonyl-1-(2,2,5-trimethyl-1,3-dioxane-5-carbonyl)piperidine-2-carboxylic acid (PubChem CID 23513837) has the molecular formula C24H31NO8S and a molecular weight of 493.58 g/mol. Its IUPAC name is 4-(4-but-2-ynoxyphenyl)sulfonyl-1-(2,2,5-trimethyl-1,3-dioxane-5-carbonyl)piperidine-2-carboxylic acid.
| Compound Name | 4-(4-but-2-ynoxyphenyl)sulfonyl-1-(2,2,5-trimethyl-1,3-dioxane-5-carbonyl)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 23513837 |
| Molecular Formula | C24H31NO8S |
| Molecular Weight | 493.58 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | 4-(4-but-2-ynoxyphenyl)sulfonyl-1-(2,2,5-trimethyl-1,3-dioxane-5-carbonyl)piperidine-2-carboxylic acid |
| SMILES | CC#CCOc1ccc(S(=O)(=O)C2CCN(C(=O)C3(C)COC(C)(C)OC3)C(C(=O)O)C2)cc1 |
| InChI | InChI=1S/C24H31NO8S/c1-5-6-13-31-17-7-9-18(10-8-17)34(29,30)19-11-12-25(20(14-19)21(26)27)22(28)24(4)15-32-23(2,3)33-16-24/h7-10,19-20H,11-16H2,1-4H3,(H,26,27) |
| InChIKey | LWKZYFYBFXSYJJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.58 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|