C12H12N8O3 — CID 23514227
6-phenyl-1,3,5-triazine-2,4-diamine;1,3,5-triazinane-2,4,6-trione (PubChem CID 23514227) has the molecular formula C12H12N8O3 and a molecular weight of 316.28 g/mol. Its IUPAC name is 6-phenyl-1,3,5-triazine-2,4-diamine;1,3,5-triazinane-2,4,6-trione.
| Compound Name | 6-phenyl-1,3,5-triazine-2,4-diamine;1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 23514227 |
| Molecular Formula | C12H12N8O3 |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 6-phenyl-1,3,5-triazine-2,4-diamine;1,3,5-triazinane-2,4,6-trione |
| SMILES | Nc1nc(N)nc(-c2ccccc2)n1.O=c1[nH]c(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C9H9N5.C3H3N3O3/c10-8-12-7(13-9(11)14-8)6-4-2-1-3-5-6;7-1-4-2(8)6-3(9)5-1/h1-5H,(H4,10,11,12,13,14);(H3,4,5,6,7,8,9) |
| InChIKey | LEWNHNKEWYYLFL-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 189.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |