C19H15N3O3 — CID 2351439
(2E,4E)-N-benzyl-2-cyano-5-(2-nitrophenyl)penta-2,4-dienamide (PubChem CID 2351439) has the molecular formula C19H15N3O3 and a molecular weight of 333.35 g/mol. Its IUPAC name is (2E,4E)-N-benzyl-2-cyano-5-(2-nitrophenyl)penta-2,4-dienamide.
| Compound Name | (2E,4E)-N-benzyl-2-cyano-5-(2-nitrophenyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 2351439 |
| Molecular Formula | C19H15N3O3 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | (2E,4E)-N-benzyl-2-cyano-5-(2-nitrophenyl)penta-2,4-dienamide |
| SMILES | N#C/C(=C\C=C\c1ccccc1[N+](=O)[O-])C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C19H15N3O3/c20-13-17(19(23)21-14-15-7-2-1-3-8-15)11-6-10-16-9-4-5-12-18(16)22(24)25/h1-12H,14H2,(H,21,23)/b10-6+,17-11+ |
| InChIKey | FNWRTFAVXNMUGW-ANKJDYFYSA-N |
| XLogP | 3.37 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|