C24H31F2N3O — CID 23515015
1-[4-[4-[3-(1,1-difluoroethyl)phenyl]piperazin-1-yl]butyl]-6,7-dihydro-5H-indol-4-one (PubChem CID 23515015) has the molecular formula C24H31F2N3O and a molecular weight of 415.53 g/mol. Its IUPAC name is 1-[4-[4-[3-(1,1-difluoroethyl)phenyl]piperazin-1-yl]butyl]-6,7-dihydro-5H-indol-4-one.
| Compound Name | 1-[4-[4-[3-(1,1-difluoroethyl)phenyl]piperazin-1-yl]butyl]-6,7-dihydro-5H-indol-4-one |
|---|---|
| PubChem CID | 23515015 |
| Molecular Formula | C24H31F2N3O |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | 1-[4-[4-[3-(1,1-difluoroethyl)phenyl]piperazin-1-yl]butyl]-6,7-dihydro-5H-indol-4-one |
| SMILES | CC(F)(F)c1cccc(N2CCN(CCCCn3ccc4c3CCCC4=O)CC2)c1 |
| InChI | InChI=1S/C24H31F2N3O/c1-24(25,26)19-6-4-7-20(18-19)28-16-14-27(15-17-28)11-2-3-12-29-13-10-21-22(29)8-5-9-23(21)30/h4,6-7,10,13,18H,2-3,5,8-9,11-12,14-17H2,1H3 |
| InChIKey | IVHMJAARKQOZQB-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|