About 1-cyclohexyl-2-[4-[(2,4-dichlorophenyl)methylcarbamoyl]phenyl]benzimidazole-5-carboxylic acid
1-cyclohexyl-2-[4-[(2,4-dichlorophenyl)methylcarbamoyl]phenyl]benzimidazole-5-carboxylic acid (PubChem CID 23515558) has the molecular formula C28H25Cl2N3O3
and a molecular weight of 522.43 g/mol. Its IUPAC name is 1-cyclohexyl-2-[4-[(2,4-dichlorophenyl)methylcarbamoyl]phenyl]benzimidazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 1-cyclohexyl-2-[4-[(2,4-dichlorophenyl)methylcarbamoyl]phenyl]benzimidazole-5-carboxylic acid |
| PubChem CID | 23515558 |
| Molecular Formula | C28H25Cl2N3O3 |
| Molecular Weight | 522.43 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | 1-cyclohexyl-2-[4-[(2,4-dichlorophenyl)methylcarbamoyl]phenyl]benzimidazole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)nc(-c1ccc(C(=O)NCc3ccc(Cl)cc3Cl)cc1)n2C1CCCCC1 |
| InChI | InChI=1S/C28H25Cl2N3O3/c29-21-12-10-20(23(30)15-21)16-31-27(34)18-8-6-17(7-9-18)26-32-24-14-19(28(35)36)11-13-25(24)33(26)22-4-2-1-3-5-22/h6-15,22H,1-5,16H2,(H,31,34)(H,35,36) |
| InChIKey | WPYCTGFFOUFJJE-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 522.43 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-cyclohexyl-2-[4-[(2,4-dichlorophenyl)methylcarbamoyl]phenyl]benzimidazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-2-[4-[(2,4-dichlorophenyl)methylcarbamoyl]phenyl]benzimidazole-5-carboxylic acid?
The IUPAC name of 1-cyclohexyl-2-[4-[(2,4-dichlorophenyl)methylcarbamoyl]phenyl]benzimidazole-5-carboxylic acid (CID 23515558) is 1-cyclohexyl-2-[4-[(2,4-dichlorophenyl)methylcarbamoyl]phenyl]benzimidazole-5-carboxylic acid.
What is the SMILES notation for 1-cyclohexyl-2-[4-[(2,4-dichlorophenyl)methylcarbamoyl]phenyl]benzimidazole-5-carboxylic acid?
The canonical SMILES for 1-cyclohexyl-2-[4-[(2,4-dichlorophenyl)methylcarbamoyl]phenyl]benzimidazole-5-carboxylic acid is O=C(O)c1ccc2c(c1)nc(-c1ccc(C(=O)NCc3ccc(Cl)cc3Cl)cc1)n2C1CCCCC1.
What is the InChIKey of 1-cyclohexyl-2-[4-[(2,4-dichlorophenyl)methylcarbamoyl]phenyl]benzimidazole-5-carboxylic acid?
The InChIKey is WPYCTGFFOUFJJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H25Cl2N3O3/c29-21-12-10-20(23(30)15-21)16-31-27(34)18-8-6-17(7-9-18)26-32-24-14-19(28(35)36)11-13-25(24)33(26)22-4-2-1-3-5-22/h6-15,22H,1-5,16H2,(H,31,34)(H,35,36).
What are the key properties of 1-cyclohexyl-2-[4-[(2,4-dichlorophenyl)methylcarbamoyl]phenyl]benzimidazole-5-carboxylic acid?
1-cyclohexyl-2-[4-[(2,4-dichlorophenyl)methylcarbamoyl]phenyl]benzimidazole-5-carboxylic acid has a molecular weight of 522.43 g/mol, XLogP of 7.14, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-2-[4-[(2,4-dichlorophenyl)methylcarbamoyl]phenyl]benzimidazole-5-carboxylic acid is sourced from PubChem (CID 23515558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).