C24H20F3N3O2 — CID 23515832
1-cyclopentyl-2-[5-[2-(trifluoromethyl)phenyl]furan-2-yl]benzimidazole-5-carboxamide (PubChem CID 23515832) has the molecular formula C24H20F3N3O2 and a molecular weight of 439.44 g/mol. Its IUPAC name is 1-cyclopentyl-2-[5-[2-(trifluoromethyl)phenyl]furan-2-yl]benzimidazole-5-carboxamide.
| Compound Name | 1-cyclopentyl-2-[5-[2-(trifluoromethyl)phenyl]furan-2-yl]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 23515832 |
| Molecular Formula | C24H20F3N3O2 |
| Molecular Weight | 439.44 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 1-cyclopentyl-2-[5-[2-(trifluoromethyl)phenyl]furan-2-yl]benzimidazole-5-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)nc(-c1ccc(-c3ccccc3C(F)(F)F)o1)n2C1CCCC1 |
| InChI | InChI=1S/C24H20F3N3O2/c25-24(26,27)17-8-4-3-7-16(17)20-11-12-21(32-20)23-29-18-13-14(22(28)31)9-10-19(18)30(23)15-5-1-2-6-15/h3-4,7-13,15H,1-2,5-6H2,(H2,28,31) |
| InChIKey | NXQGEEDCYNZHOV-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 74.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.44 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |