C4H6N4O2 — CID 23516186
6-amino-3-methyl-1H-1,3,5-triazine-2,4-dione (PubChem CID 23516186) has the molecular formula C4H6N4O2 and a molecular weight of 142.12 g/mol. Its IUPAC name is 6-amino-3-methyl-1H-1,3,5-triazine-2,4-dione.
| Compound Name | 6-amino-3-methyl-1H-1,3,5-triazine-2,4-dione |
|---|---|
| PubChem CID | 23516186 |
| Molecular Formula | C4H6N4O2 |
| Molecular Weight | 142.12 g/mol |
| Exact Mass | 142.05 |
| IUPAC Name | 6-amino-3-methyl-1H-1,3,5-triazine-2,4-dione |
| SMILES | Cn1c(=O)nc(N)[nH]c1=O |
| InChI | InChI=1S/C4H6N4O2/c1-8-3(9)6-2(5)7-4(8)10/h1H3,(H3,5,6,7,9,10) |
| InChIKey | XSMWJRWXZWBGFQ-UHFFFAOYSA-N |
| XLogP | -1.95 |
| TPSA | 93.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.12 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |