About 5-amino-2-methyl-1,2,4-triazin-3-one
5-amino-2-methyl-1,2,4-triazin-3-one (PubChem CID 23516196) has the molecular formula C4H6N4O
and a molecular weight of 126.12 g/mol. Its IUPAC name is 5-amino-2-methyl-1,2,4-triazin-3-one.
Molecular Properties
| Compound Name | 5-amino-2-methyl-1,2,4-triazin-3-one |
| PubChem CID | 23516196 |
| Molecular Formula | C4H6N4O |
| Molecular Weight | 126.12 g/mol |
| Exact Mass | 126.05 |
| IUPAC Name | 5-amino-2-methyl-1,2,4-triazin-3-one |
| SMILES | Cn1ncc(N)nc1=O |
| InChI | InChI=1S/C4H6N4O/c1-8-4(9)7-3(5)2-6-8/h2H,1H3,(H2,5,7,9) |
| InChIKey | PFIOZJBSESOVGS-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.12 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-amino-2-methyl-1,2,4-triazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-methyl-1,2,4-triazin-3-one?
The IUPAC name of 5-amino-2-methyl-1,2,4-triazin-3-one (CID 23516196) is 5-amino-2-methyl-1,2,4-triazin-3-one.
What is the SMILES notation for 5-amino-2-methyl-1,2,4-triazin-3-one?
The canonical SMILES for 5-amino-2-methyl-1,2,4-triazin-3-one is Cn1ncc(N)nc1=O.
What is the InChIKey of 5-amino-2-methyl-1,2,4-triazin-3-one?
The InChIKey is PFIOZJBSESOVGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N4O/c1-8-4(9)7-3(5)2-6-8/h2H,1H3,(H2,5,7,9).
What are the key properties of 5-amino-2-methyl-1,2,4-triazin-3-one?
5-amino-2-methyl-1,2,4-triazin-3-one has a molecular weight of 126.12 g/mol, XLogP of -1.24, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-methyl-1,2,4-triazin-3-one is sourced from PubChem (CID 23516196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).