About CID 23516197
CID 23516197 (PubChem CID 23516197) has the molecular formula C7H11BO4Y
and a molecular weight of 258.88 g/mol.
Molecular Properties
| Compound Name | CID 23516197 |
| PubChem CID | 23516197 |
| Molecular Formula | C7H11BO4Y |
| Molecular Weight | 258.88 g/mol |
| Exact Mass | 258.98 |
| IUPAC Name | — |
| SMILES | [B]C1OC2(COC)COC1C2O.[Y] |
| InChI | InChI=1S/C7H11BO4.Y/c1-10-2-7-3-11-4(5(7)9)6(8)12-7;/h4-6,9H,2-3H2,1H3; |
| InChIKey | ZEHGOCYCPLNTHL-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.88 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 23516197 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 23516197?
The IUPAC name of CID 23516197 (CID 23516197) is not available.
What is the SMILES notation for CID 23516197?
The canonical SMILES for CID 23516197 is [B]C1OC2(COC)COC1C2O.[Y].
What is the InChIKey of CID 23516197?
The InChIKey is ZEHGOCYCPLNTHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11BO4.Y/c1-10-2-7-3-11-4(5(7)9)6(8)12-7;/h4-6,9H,2-3H2,1H3;.
What are the key properties of CID 23516197?
CID 23516197 has a molecular weight of 258.88 g/mol, XLogP of -1.35, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 23516197 is sourced from PubChem (CID 23516197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).