C20H9F3O6 — CID 23516475
12-methyl-16-methylidene-12-(trifluoromethyl)-2,7,17-trioxapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3(11),4,9,14,19-hexaene-6,8,18-trione (PubChem CID 23516475) has the molecular formula C20H9F3O6 and a molecular weight of 402.28 g/mol. Its IUPAC name is 12-methyl-16-methylidene-12-(trifluoromethyl)-2,7,17-trioxapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3(11),4,9,14,19-hexaene-6,8,18-trione.
| Compound Name | 12-methyl-16-methylidene-12-(trifluoromethyl)-2,7,17-trioxapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3(11),4,9,14,19-hexaene-6,8,18-trione |
|---|---|
| PubChem CID | 23516475 |
| Molecular Formula | C20H9F3O6 |
| Molecular Weight | 402.28 g/mol |
| Exact Mass | 402.04 |
| IUPAC Name | 12-methyl-16-methylidene-12-(trifluoromethyl)-2,7,17-trioxapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3(11),4,9,14,19-hexaene-6,8,18-trione |
| SMILES | C=C1OC(=O)c2cc3c(cc21)C(C)(C(F)(F)F)c1cc2c(cc1O3)C(=O)OC2=O |
| InChI | InChI=1S/C20H9F3O6/c1-7-8-3-12-14(5-10(8)16(24)27-7)28-15-6-11-9(17(25)29-18(11)26)4-13(15)19(12,2)20(21,22)23/h3-6H,1H2,2H3 |
| InChIKey | KCDIYNZUYZNFHY-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.28 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|