C39H51N5O6 — CID 23516492
[7-[[2-tert-butyl-4-methyl-6-(2-methylpropyl)cyclohexyl]methyl]-2-(2,5-dimethylphenyl)-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] N,N-bis(2-ethynylperoxyethyl)carbamate (PubChem CID 23516492) has the molecular formula C39H51N5O6 and a molecular weight of 685.87 g/mol. Its IUPAC name is [7-[[2-tert-butyl-4-methyl-6-(2-methylpropyl)cyclohexyl]methyl]-2-(2,5-dimethylphenyl)-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] N,N-bis(2-ethynylperoxyethyl)carbamate.
| Compound Name | [7-[[2-tert-butyl-4-methyl-6-(2-methylpropyl)cyclohexyl]methyl]-2-(2,5-dimethylphenyl)-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] N,N-bis(2-ethynylperoxyethyl)carbamate |
|---|---|
| PubChem CID | 23516492 |
| Molecular Formula | C39H51N5O6 |
| Molecular Weight | 685.87 g/mol |
| Exact Mass | 685.38 |
| IUPAC Name | [7-[[2-tert-butyl-4-methyl-6-(2-methylpropyl)cyclohexyl]methyl]-2-(2,5-dimethylphenyl)-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] N,N-bis(2-ethynylperoxyethyl)carbamate |
| SMILES | [C-]#[N+]c1c(CC2C(CC(C)C)CC(C)CC2C(C)(C)C)c2nc(-c3cc(C)ccc3C)[nH]n2c1OC(=O)N(CCOOC#C)CCOOC#C |
| InChI | InChI=1S/C39H51N5O6/c1-12-46-48-18-16-43(17-19-49-47-13-2)38(45)50-37-34(40-11)32(36-41-35(42-44(36)37)30-22-26(5)14-15-28(30)7)24-31-29(20-25(3)4)21-27(6)23-33(31)39(8,9)10/h1-2,14-15,22,25,27,29,31,33H,16-21,23-24H2,3-10H3,(H,41,42) |
| InChIKey | DQGNMPHSSJPTBW-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 103.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.87 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|