C37H49N7O2 — CID 23516493
[7-[[2-tert-butyl-4-methyl-6-(2-methylpropyl)cyclohexyl]methyl]-2-(2,5-dimethylphenyl)-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] N,N-bis(2-isocyanoethyl)carbamate (PubChem CID 23516493) has the molecular formula C37H49N7O2 and a molecular weight of 623.85 g/mol. Its IUPAC name is [7-[[2-tert-butyl-4-methyl-6-(2-methylpropyl)cyclohexyl]methyl]-2-(2,5-dimethylphenyl)-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] N,N-bis(2-isocyanoethyl)carbamate.
| Compound Name | [7-[[2-tert-butyl-4-methyl-6-(2-methylpropyl)cyclohexyl]methyl]-2-(2,5-dimethylphenyl)-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] N,N-bis(2-isocyanoethyl)carbamate |
|---|---|
| PubChem CID | 23516493 |
| Molecular Formula | C37H49N7O2 |
| Molecular Weight | 623.85 g/mol |
| Exact Mass | 623.39 |
| IUPAC Name | [7-[[2-tert-butyl-4-methyl-6-(2-methylpropyl)cyclohexyl]methyl]-2-(2,5-dimethylphenyl)-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] N,N-bis(2-isocyanoethyl)carbamate |
| SMILES | [C-]#[N+]CCN(CC[N+]#[C-])C(=O)Oc1c([N+]#[C-])c(CC2C(CC(C)C)CC(C)CC2C(C)(C)C)c2nc(-c3cc(C)ccc3C)[nH]n12 |
| InChI | InChI=1S/C37H49N7O2/c1-23(2)18-27-19-25(4)21-31(37(6,7)8)29(27)22-30-32(40-11)35(46-36(45)43(16-14-38-9)17-15-39-10)44-34(30)41-33(42-44)28-20-24(3)12-13-26(28)5/h12-13,20,23,25,27,29,31H,14-19,21-22H2,1-8H3,(H,41,42) |
| InChIKey | SNSRQKHSOCQYDK-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.85 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|