C37H53N5O3 — CID 23516497
[7-[[2-tert-butyl-4-methyl-6-(2-methylpropyl)cyclohexyl]methyl]-2-(3,4-dimethylphenyl)-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] 2,6-dimethylmorpholine-4-carboxylate (PubChem CID 23516497) has the molecular formula C37H53N5O3 and a molecular weight of 615.86 g/mol. Its IUPAC name is [7-[[2-tert-butyl-4-methyl-6-(2-methylpropyl)cyclohexyl]methyl]-2-(3,4-dimethylphenyl)-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] 2,6-dimethylmorpholine-4-carboxylate.
| Compound Name | [7-[[2-tert-butyl-4-methyl-6-(2-methylpropyl)cyclohexyl]methyl]-2-(3,4-dimethylphenyl)-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] 2,6-dimethylmorpholine-4-carboxylate |
|---|---|
| PubChem CID | 23516497 |
| Molecular Formula | C37H53N5O3 |
| Molecular Weight | 615.86 g/mol |
| Exact Mass | 615.41 |
| IUPAC Name | [7-[[2-tert-butyl-4-methyl-6-(2-methylpropyl)cyclohexyl]methyl]-2-(3,4-dimethylphenyl)-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] 2,6-dimethylmorpholine-4-carboxylate |
| SMILES | [C-]#[N+]c1c(CC2C(CC(C)C)CC(C)CC2C(C)(C)C)c2nc(-c3ccc(C)c(C)c3)[nH]n2c1OC(=O)N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C37H53N5O3/c1-21(2)14-28-15-22(3)16-31(37(8,9)10)29(28)18-30-32(38-11)35(45-36(43)41-19-25(6)44-26(7)20-41)42-34(30)39-33(40-42)27-13-12-23(4)24(5)17-27/h12-13,17,21-22,25-26,28-29,31H,14-16,18-20H2,1-10H3,(H,39,40) |
| InChIKey | ZDIIXMBSMPFCPO-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.86 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|