C37H51N5O2 — CID 23516498
[7-[[2-tert-butyl-4-methyl-6-(2-methylpropyl)cyclohexyl]methyl]-2-(3,4-dimethylphenyl)-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] N,N-bis(prop-2-enyl)carbamate (PubChem CID 23516498) has the molecular formula C37H51N5O2 and a molecular weight of 597.85 g/mol. Its IUPAC name is [7-[[2-tert-butyl-4-methyl-6-(2-methylpropyl)cyclohexyl]methyl]-2-(3,4-dimethylphenyl)-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] N,N-bis(prop-2-enyl)carbamate.
| Compound Name | [7-[[2-tert-butyl-4-methyl-6-(2-methylpropyl)cyclohexyl]methyl]-2-(3,4-dimethylphenyl)-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] N,N-bis(prop-2-enyl)carbamate |
|---|---|
| PubChem CID | 23516498 |
| Molecular Formula | C37H51N5O2 |
| Molecular Weight | 597.85 g/mol |
| Exact Mass | 597.40 |
| IUPAC Name | [7-[[2-tert-butyl-4-methyl-6-(2-methylpropyl)cyclohexyl]methyl]-2-(3,4-dimethylphenyl)-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] N,N-bis(prop-2-enyl)carbamate |
| SMILES | [C-]#[N+]c1c(CC2C(CC(C)C)CC(C)CC2C(C)(C)C)c2nc(-c3ccc(C)c(C)c3)[nH]n2c1OC(=O)N(CC=C)CC=C |
| InChI | InChI=1S/C37H51N5O2/c1-12-16-41(17-13-2)36(43)44-35-32(38-11)30(34-39-33(40-42(34)35)27-15-14-25(6)26(7)21-27)22-29-28(18-23(3)4)19-24(5)20-31(29)37(8,9)10/h12-15,21,23-24,28-29,31H,1-2,16-20,22H2,3-10H3,(H,39,40) |
| InChIKey | AJUQFAONYRGWEY-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 66.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.85 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|