C29H37N5O3 — CID 23516515
[7-[(2,6-dimethylcyclohexyl)methyl]-6-isocyano-2-(2,4,5-trimethylphenyl)-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] morpholine-4-carboxylate (PubChem CID 23516515) has the molecular formula C29H37N5O3 and a molecular weight of 503.65 g/mol. Its IUPAC name is [7-[(2,6-dimethylcyclohexyl)methyl]-6-isocyano-2-(2,4,5-trimethylphenyl)-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] morpholine-4-carboxylate.
| Compound Name | [7-[(2,6-dimethylcyclohexyl)methyl]-6-isocyano-2-(2,4,5-trimethylphenyl)-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] morpholine-4-carboxylate |
|---|---|
| PubChem CID | 23516515 |
| Molecular Formula | C29H37N5O3 |
| Molecular Weight | 503.65 g/mol |
| Exact Mass | 503.29 |
| IUPAC Name | [7-[(2,6-dimethylcyclohexyl)methyl]-6-isocyano-2-(2,4,5-trimethylphenyl)-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] morpholine-4-carboxylate |
| SMILES | [C-]#[N+]c1c(CC2C(C)CCCC2C)c2nc(-c3cc(C)c(C)cc3C)[nH]n2c1OC(=O)N1CCOCC1 |
| InChI | InChI=1S/C29H37N5O3/c1-17-8-7-9-18(2)22(17)16-24-25(30-6)28(37-29(35)33-10-12-36-13-11-33)34-27(24)31-26(32-34)23-15-20(4)19(3)14-21(23)5/h14-15,17-18,22H,7-13,16H2,1-5H3,(H,31,32) |
| InChIKey | QTXXLKAXHMFQTG-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.65 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|