About (3R)-7-chlorospiro[1H-indole-3,3'-2,6-dihydro-1H-pyridine]-2-one;hydrochloride
(3R)-7-chlorospiro[1H-indole-3,3'-2,6-dihydro-1H-pyridine]-2-one;hydrochloride (PubChem CID 23516925) has the molecular formula C12H12Cl2N2O
and a molecular weight of 271.15 g/mol. Its IUPAC name is (3R)-7-chlorospiro[1H-indole-3,3'-2,6-dihydro-1H-pyridine]-2-one;hydrochloride.
Molecular Properties
| Compound Name | (3R)-7-chlorospiro[1H-indole-3,3'-2,6-dihydro-1H-pyridine]-2-one;hydrochloride |
| PubChem CID | 23516925 |
| Molecular Formula | C12H12Cl2N2O |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | (3R)-7-chlorospiro[1H-indole-3,3'-2,6-dihydro-1H-pyridine]-2-one;hydrochloride |
| SMILES | Cl.O=C1Nc2c(Cl)cccc2[C@@]12C=CCNC2 |
| InChI | InChI=1S/C12H11ClN2O.ClH/c13-9-4-1-3-8-10(9)15-11(16)12(8)5-2-6-14-7-12;/h1-5,14H,6-7H2,(H,15,16);1H/t12-;/m0./s1 |
| InChIKey | NVDKENWLIYUNOV-YDALLXLXSA-N |
| XLogP | 2.11 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3R)-7-chlorospiro[1H-indole-3,3'-2,6-dihydro-1H-pyridine]-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-7-chlorospiro[1H-indole-3,3'-2,6-dihydro-1H-pyridine]-2-one;hydrochloride?
The IUPAC name of (3R)-7-chlorospiro[1H-indole-3,3'-2,6-dihydro-1H-pyridine]-2-one;hydrochloride (CID 23516925) is (3R)-7-chlorospiro[1H-indole-3,3'-2,6-dihydro-1H-pyridine]-2-one;hydrochloride.
What is the SMILES notation for (3R)-7-chlorospiro[1H-indole-3,3'-2,6-dihydro-1H-pyridine]-2-one;hydrochloride?
The canonical SMILES for (3R)-7-chlorospiro[1H-indole-3,3'-2,6-dihydro-1H-pyridine]-2-one;hydrochloride is Cl.O=C1Nc2c(Cl)cccc2[C@@]12C=CCNC2.
What is the InChIKey of (3R)-7-chlorospiro[1H-indole-3,3'-2,6-dihydro-1H-pyridine]-2-one;hydrochloride?
The InChIKey is NVDKENWLIYUNOV-YDALLXLXSA-N. The full InChI is InChI=1S/C12H11ClN2O.ClH/c13-9-4-1-3-8-10(9)15-11(16)12(8)5-2-6-14-7-12;/h1-5,14H,6-7H2,(H,15,16);1H/t12-;/m0./s1.
What are the key properties of (3R)-7-chlorospiro[1H-indole-3,3'-2,6-dihydro-1H-pyridine]-2-one;hydrochloride?
(3R)-7-chlorospiro[1H-indole-3,3'-2,6-dihydro-1H-pyridine]-2-one;hydrochloride has a molecular weight of 271.15 g/mol, XLogP of 2.11, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-7-chlorospiro[1H-indole-3,3'-2,6-dihydro-1H-pyridine]-2-one;hydrochloride is sourced from PubChem (CID 23516925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).