C20H21FN4O3S — CID 23516968
4-[[1-(4-fluorobutyl)benzimidazol-2-yl]methyl]-2-methyl-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-one (PubChem CID 23516968) has the molecular formula C20H21FN4O3S and a molecular weight of 416.48 g/mol. Its IUPAC name is 4-[[1-(4-fluorobutyl)benzimidazol-2-yl]methyl]-2-methyl-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-one.
| Compound Name | 4-[[1-(4-fluorobutyl)benzimidazol-2-yl]methyl]-2-methyl-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-one |
|---|---|
| PubChem CID | 23516968 |
| Molecular Formula | C20H21FN4O3S |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 4-[[1-(4-fluorobutyl)benzimidazol-2-yl]methyl]-2-methyl-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-one |
| SMILES | CN1C(=O)N(Cc2nc3ccccc3n2CCCCF)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C20H21FN4O3S/c1-23-20(26)25(17-10-4-5-11-18(17)29(23,27)28)14-19-22-15-8-2-3-9-16(15)24(19)13-7-6-12-21/h2-5,8-11H,6-7,12-14H2,1H3 |
| InChIKey | DDULIOCLRHKNBJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|