C21H17F3N6O2 — CID 23517095
4-[2-[[(3E)-2-oxo-3-(2,2,2-trifluoroethoxyimino)pyrrolo[2,3-b]pyridin-1-yl]methyl]benzimidazol-1-yl]butanenitrile (PubChem CID 23517095) has the molecular formula C21H17F3N6O2 and a molecular weight of 442.40 g/mol. Its IUPAC name is 4-[2-[[(3E)-2-oxo-3-(2,2,2-trifluoroethoxyimino)pyrrolo[2,3-b]pyridin-1-yl]methyl]benzimidazol-1-yl]butanenitrile.
| Compound Name | 4-[2-[[(3E)-2-oxo-3-(2,2,2-trifluoroethoxyimino)pyrrolo[2,3-b]pyridin-1-yl]methyl]benzimidazol-1-yl]butanenitrile |
|---|---|
| PubChem CID | 23517095 |
| Molecular Formula | C21H17F3N6O2 |
| Molecular Weight | 442.40 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 4-[2-[[(3E)-2-oxo-3-(2,2,2-trifluoroethoxyimino)pyrrolo[2,3-b]pyridin-1-yl]methyl]benzimidazol-1-yl]butanenitrile |
| SMILES | N#CCCCn1c(CN2C(=O)/C(=N/OCC(F)(F)F)c3cccnc32)nc2ccccc21 |
| InChI | InChI=1S/C21H17F3N6O2/c22-21(23,24)13-32-28-18-14-6-5-10-26-19(14)30(20(18)31)12-17-27-15-7-1-2-8-16(15)29(17)11-4-3-9-25/h1-2,5-8,10H,3-4,11-13H2/b28-18+ |
| InChIKey | LQBXRELLYBGLQL-MTDXEUNCSA-N |
| XLogP | 3.56 |
| TPSA | 96.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|