About 4-fluoro-1-N-[2-(tetrazol-1-yl)ethyl]benzene-1,2-diamine
4-fluoro-1-N-[2-(tetrazol-1-yl)ethyl]benzene-1,2-diamine (PubChem CID 23517109) has the molecular formula C9H11FN6
and a molecular weight of 222.23 g/mol. Its IUPAC name is 4-fluoro-1-N-[2-(tetrazol-1-yl)ethyl]benzene-1,2-diamine.
Molecular Properties
| Compound Name | 4-fluoro-1-N-[2-(tetrazol-1-yl)ethyl]benzene-1,2-diamine |
| PubChem CID | 23517109 |
| Molecular Formula | C9H11FN6 |
| Molecular Weight | 222.23 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 4-fluoro-1-N-[2-(tetrazol-1-yl)ethyl]benzene-1,2-diamine |
| SMILES | Nc1cc(F)ccc1NCCn1cnnn1 |
| InChI | InChI=1S/C9H11FN6/c10-7-1-2-9(8(11)5-7)12-3-4-16-6-13-14-15-16/h1-2,5-6,12H,3-4,11H2 |
| InChIKey | KCMBOTNZVZXHKZ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.23 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoro-1-N-[2-(tetrazol-1-yl)ethyl]benzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-1-N-[2-(tetrazol-1-yl)ethyl]benzene-1,2-diamine?
The IUPAC name of 4-fluoro-1-N-[2-(tetrazol-1-yl)ethyl]benzene-1,2-diamine (CID 23517109) is 4-fluoro-1-N-[2-(tetrazol-1-yl)ethyl]benzene-1,2-diamine.
What is the SMILES notation for 4-fluoro-1-N-[2-(tetrazol-1-yl)ethyl]benzene-1,2-diamine?
The canonical SMILES for 4-fluoro-1-N-[2-(tetrazol-1-yl)ethyl]benzene-1,2-diamine is Nc1cc(F)ccc1NCCn1cnnn1.
What is the InChIKey of 4-fluoro-1-N-[2-(tetrazol-1-yl)ethyl]benzene-1,2-diamine?
The InChIKey is KCMBOTNZVZXHKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11FN6/c10-7-1-2-9(8(11)5-7)12-3-4-16-6-13-14-15-16/h1-2,5-6,12H,3-4,11H2.
What are the key properties of 4-fluoro-1-N-[2-(tetrazol-1-yl)ethyl]benzene-1,2-diamine?
4-fluoro-1-N-[2-(tetrazol-1-yl)ethyl]benzene-1,2-diamine has a molecular weight of 222.23 g/mol, XLogP of 0.51, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-1-N-[2-(tetrazol-1-yl)ethyl]benzene-1,2-diamine is sourced from PubChem (CID 23517109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).