C22H23FN4O3S — CID 23517130
2-cyclopropyl-4-[[1-(4-fluorobutyl)benzimidazol-2-yl]methyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-one (PubChem CID 23517130) has the molecular formula C22H23FN4O3S and a molecular weight of 442.52 g/mol. Its IUPAC name is 2-cyclopropyl-4-[[1-(4-fluorobutyl)benzimidazol-2-yl]methyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-one.
| Compound Name | 2-cyclopropyl-4-[[1-(4-fluorobutyl)benzimidazol-2-yl]methyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-one |
|---|---|
| PubChem CID | 23517130 |
| Molecular Formula | C22H23FN4O3S |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 2-cyclopropyl-4-[[1-(4-fluorobutyl)benzimidazol-2-yl]methyl]-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-one |
| SMILES | O=C1N(Cc2nc3ccccc3n2CCCCF)c2ccccc2S(=O)(=O)N1C1CC1 |
| InChI | InChI=1S/C22H23FN4O3S/c23-13-5-6-14-25-18-8-2-1-7-17(18)24-21(25)15-26-19-9-3-4-10-20(19)31(29,30)27(22(26)28)16-11-12-16/h1-4,7-10,16H,5-6,11-15H2 |
| InChIKey | CGICPAYSWHONEI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|