C19H36O2Si — CID 23517391
7a-methyl-1-(1-triethylsilyloxypropan-2-yl)-2,3,3a,5,6,7-hexahydro-1H-inden-4-one (PubChem CID 23517391) has the molecular formula C19H36O2Si and a molecular weight of 324.58 g/mol. Its IUPAC name is 7a-methyl-1-(1-triethylsilyloxypropan-2-yl)-2,3,3a,5,6,7-hexahydro-1H-inden-4-one.
| Compound Name | 7a-methyl-1-(1-triethylsilyloxypropan-2-yl)-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 23517391 |
| Molecular Formula | C19H36O2Si |
| Molecular Weight | 324.58 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | 7a-methyl-1-(1-triethylsilyloxypropan-2-yl)-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
| SMILES | CC[Si](CC)(CC)OCC(C)C1CCC2C(=O)CCCC21C |
| InChI | InChI=1S/C19H36O2Si/c1-6-22(7-2,8-3)21-14-15(4)16-11-12-17-18(20)10-9-13-19(16,17)5/h15-17H,6-14H2,1-5H3 |
| InChIKey | ZNNRSADKBZRGNQ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.58 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|