C28H20N2O8S2 — CID 23517483
2-[1,8-diamino-7-[2-(dihydroxymethyl)phenyl]sulfanyl-4,5-dihydroxy-9,10-dioxoanthracen-2-yl]sulfanylbenzoic acid (PubChem CID 23517483) has the molecular formula C28H20N2O8S2 and a molecular weight of 576.61 g/mol. Its IUPAC name is 2-[1,8-diamino-7-[2-(dihydroxymethyl)phenyl]sulfanyl-4,5-dihydroxy-9,10-dioxoanthracen-2-yl]sulfanylbenzoic acid.
| Compound Name | 2-[1,8-diamino-7-[2-(dihydroxymethyl)phenyl]sulfanyl-4,5-dihydroxy-9,10-dioxoanthracen-2-yl]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 23517483 |
| Molecular Formula | C28H20N2O8S2 |
| Molecular Weight | 576.61 g/mol |
| Exact Mass | 576.07 |
| IUPAC Name | 2-[1,8-diamino-7-[2-(dihydroxymethyl)phenyl]sulfanyl-4,5-dihydroxy-9,10-dioxoanthracen-2-yl]sulfanylbenzoic acid |
| SMILES | Nc1c(Sc2ccccc2C(=O)O)cc(O)c2c1C(=O)c1c(N)c(Sc3ccccc3C(O)O)cc(O)c1C2=O |
| InChI | InChI=1S/C28H20N2O8S2/c29-23-17(39-15-7-3-1-5-11(15)27(35)36)9-13(31)19-21(23)26(34)22-20(25(19)33)14(32)10-18(24(22)30)40-16-8-4-2-6-12(16)28(37)38/h1-10,27,31-32,35-36H,29-30H2,(H,37,38) |
| InChIKey | YEFNNHVWPLHXER-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 204.40 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.61 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|