C30H33N — CID 23517903
4-[(1E)-4,4-bis(4-methylphenyl)buta-1,3-dienyl]-N-cyclohexylaniline (PubChem CID 23517903) has the molecular formula C30H33N and a molecular weight of 407.60 g/mol. Its IUPAC name is 4-[(1E)-4,4-bis(4-methylphenyl)buta-1,3-dienyl]-N-cyclohexylaniline.
| Compound Name | 4-[(1E)-4,4-bis(4-methylphenyl)buta-1,3-dienyl]-N-cyclohexylaniline |
|---|---|
| PubChem CID | 23517903 |
| Molecular Formula | C30H33N |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | 4-[(1E)-4,4-bis(4-methylphenyl)buta-1,3-dienyl]-N-cyclohexylaniline |
| SMILES | Cc1ccc(C(=C/C=C/c2ccc(NC3CCCCC3)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C30H33N/c1-23-11-17-26(18-12-23)30(27-19-13-24(2)14-20-27)10-6-7-25-15-21-29(22-16-25)31-28-8-4-3-5-9-28/h6-7,10-22,28,31H,3-5,8-9H2,1-2H3/b7-6+ |
| InChIKey | FNHRQOZBTVVGBF-VOTSOKGWSA-N |
| XLogP | 8.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|