C13H24O5Si — CID 23519143
[tert-butyl(dimethyl)silyl] 2-(2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl)acetate (PubChem CID 23519143) has the molecular formula C13H24O5Si and a molecular weight of 288.42 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] 2-(2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl)acetate.
| Compound Name | [tert-butyl(dimethyl)silyl] 2-(2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl)acetate |
|---|---|
| PubChem CID | 23519143 |
| Molecular Formula | C13H24O5Si |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] 2-(2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl)acetate |
| SMILES | CC1(C)OC(=O)C(CC(=O)O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C13H24O5Si/c1-12(2,3)19(6,7)18-10(14)8-9-11(15)17-13(4,5)16-9/h9H,8H2,1-7H3 |
| InChIKey | UZUBJZMQRZAEFN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|